C17H20N2O — CID 577333
4-(4-methoxyphenyl)-2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine (PubChem CID 577333) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine.
| Compound Name | 4-(4-methoxyphenyl)-2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 577333 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 4-(4-methoxyphenyl)-2-methyl-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
| SMILES | COc1ccc(C2CC(C)Nc3ccccc3N2)cc1 |
| InChI | InChI=1S/C17H20N2O/c1-12-11-17(13-7-9-14(20-2)10-8-13)19-16-6-4-3-5-15(16)18-12/h3-10,12,17-19H,11H2,1-2H3 |
| InChIKey | LYZHLPUKVGKKCR-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|