C15H15NOS — CID 132552157
(3R)-3-(4-methoxyphenyl)-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 132552157) has the molecular formula C15H15NOS and a molecular weight of 257.36 g/mol. Its IUPAC name is (3R)-3-(4-methoxyphenyl)-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | (3R)-3-(4-methoxyphenyl)-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 132552157 |
| Molecular Formula | C15H15NOS |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | (3R)-3-(4-methoxyphenyl)-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | COc1ccc([C@@H]2CSc3ccccc3N2)cc1 |
| InChI | InChI=1S/C15H15NOS/c1-17-12-8-6-11(7-9-12)14-10-18-15-5-3-2-4-13(15)16-14/h2-9,14,16H,10H2,1H3/t14-/m0/s1 |
| InChIKey | XEGSZLZVDACKJN-AWEZNQCLSA-N |
| XLogP | 3.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |