C18H15NS — CID 135015369
(3R)-3-naphthalen-2-yl-3,4-dihydro-2H-1,4-benzothiazine (PubChem CID 135015369) has the molecular formula C18H15NS and a molecular weight of 277.39 g/mol. Its IUPAC name is (3R)-3-naphthalen-2-yl-3,4-dihydro-2H-1,4-benzothiazine.
| Compound Name | (3R)-3-naphthalen-2-yl-3,4-dihydro-2H-1,4-benzothiazine |
|---|---|
| PubChem CID | 135015369 |
| Molecular Formula | C18H15NS |
| Molecular Weight | 277.39 g/mol |
| Exact Mass | 277.09 |
| IUPAC Name | (3R)-3-naphthalen-2-yl-3,4-dihydro-2H-1,4-benzothiazine |
| SMILES | c1ccc2c(c1)N[C@H](c1ccc3ccccc3c1)CS2 |
| InChI | InChI=1S/C18H15NS/c1-2-6-14-11-15(10-9-13(14)5-1)17-12-20-18-8-4-3-7-16(18)19-17/h1-11,17,19H,12H2/t17-/m0/s1 |
| InChIKey | JDNRDLBQBZQBQD-KRWDZBQOSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |