C19H20N2O — CID 40526644
1-[(2R,4R)-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one (PubChem CID 40526644) has the molecular formula C19H20N2O and a molecular weight of 292.38 g/mol. Its IUPAC name is 1-[(2R,4R)-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[(2R,4R)-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 40526644 |
| Molecular Formula | C19H20N2O |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.16 |
| IUPAC Name | 1-[(2R,4R)-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1[C@@H]1C[C@H](c2ccccc2)Nc2ccccc21 |
| InChI | InChI=1S/C19H20N2O/c22-19-11-6-12-21(19)18-13-17(14-7-2-1-3-8-14)20-16-10-5-4-9-15(16)18/h1-5,7-10,17-18,20H,6,11-13H2/t17-,18-/m1/s1 |
| InChIKey | VAGNKUQGTBABTE-QZTJIDSGSA-N |
| XLogP | 3.91 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |