C21H23ClN2O — CID 46866851
1-[(2S,4S)-6-chloro-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]azepan-2-one (PubChem CID 46866851) has the molecular formula C21H23ClN2O and a molecular weight of 354.88 g/mol. Its IUPAC name is 1-[(2S,4S)-6-chloro-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]azepan-2-one.
| Compound Name | 1-[(2S,4S)-6-chloro-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]azepan-2-one |
|---|---|
| PubChem CID | 46866851 |
| Molecular Formula | C21H23ClN2O |
| Molecular Weight | 354.88 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 1-[(2S,4S)-6-chloro-2-phenyl-1,2,3,4-tetrahydroquinolin-4-yl]azepan-2-one |
| SMILES | O=C1CCCCCN1[C@H]1C[C@@H](c2ccccc2)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C21H23ClN2O/c22-16-10-11-18-17(13-16)20(24-12-6-2-5-9-21(24)25)14-19(23-18)15-7-3-1-4-8-15/h1,3-4,7-8,10-11,13,19-20,23H,2,5-6,9,12,14H2/t19-,20-/m0/s1 |
| InChIKey | WLCVVMSAXBERBF-PMACEKPBSA-N |
| XLogP | 5.34 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.88 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |