C19H22N2 — CID 10333801
(2S,4S)-2-phenyl-4-pyrrolidin-1-yl-1,2,3,4-tetrahydroquinoline (PubChem CID 10333801) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (2S,4S)-2-phenyl-4-pyrrolidin-1-yl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S,4S)-2-phenyl-4-pyrrolidin-1-yl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 10333801 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (2S,4S)-2-phenyl-4-pyrrolidin-1-yl-1,2,3,4-tetrahydroquinoline |
| SMILES | c1ccc([C@@H]2C[C@H](N3CCCC3)c3ccccc3N2)cc1 |
| InChI | InChI=1S/C19H22N2/c1-2-8-15(9-3-1)18-14-19(21-12-6-7-13-21)16-10-4-5-11-17(16)20-18/h1-5,8-11,18-20H,6-7,12-14H2/t18-,19-/m0/s1 |
| InChIKey | SPSRAOYUGHBABI-OALUTQOASA-N |
| XLogP | 4.38 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |