C18H14N2O3 — CID 142755205
2-[(3S,5S)-2-oxo-5-phenylpyrrolidin-3-yl]isoindole-1,3-dione (PubChem CID 142755205) has the molecular formula C18H14N2O3 and a molecular weight of 306.32 g/mol. Its IUPAC name is 2-[(3S,5S)-2-oxo-5-phenylpyrrolidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3S,5S)-2-oxo-5-phenylpyrrolidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142755205 |
| Molecular Formula | C18H14N2O3 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 2-[(3S,5S)-2-oxo-5-phenylpyrrolidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1N[C@H](c2ccccc2)C[C@@H]1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C18H14N2O3/c21-16-15(10-14(19-16)11-6-2-1-3-7-11)20-17(22)12-8-4-5-9-13(12)18(20)23/h1-9,14-15H,10H2,(H,19,21)/t14-,15-/m0/s1 |
| InChIKey | SOEHMWVYJTYCTP-GJZGRUSLSA-N |
| XLogP | 1.91 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|