C19H17NO2 — CID 142191199
2-[(1R)-2-phenylcyclopentyl]isoindole-1,3-dione (PubChem CID 142191199) has the molecular formula C19H17NO2 and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[(1R)-2-phenylcyclopentyl]isoindole-1,3-dione.
| Compound Name | 2-[(1R)-2-phenylcyclopentyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 142191199 |
| Molecular Formula | C19H17NO2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 2-[(1R)-2-phenylcyclopentyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@@H]1CCCC1c1ccccc1 |
| InChI | InChI=1S/C19H17NO2/c21-18-15-9-4-5-10-16(15)19(22)20(18)17-12-6-11-14(17)13-7-2-1-3-8-13/h1-5,7-10,14,17H,6,11-12H2/t14?,17-/m1/s1 |
| InChIKey | OCPXVXYXAKSEDE-FBMWCMRBSA-N |
| XLogP | 3.62 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|