C32H28N2O2 — CID 132529028
2-[(2S,3S)-1-benzhydryl-2-phenylpiperidin-3-yl]isoindole-1,3-dione (PubChem CID 132529028) has the molecular formula C32H28N2O2 and a molecular weight of 472.59 g/mol. Its IUPAC name is 2-[(2S,3S)-1-benzhydryl-2-phenylpiperidin-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3S)-1-benzhydryl-2-phenylpiperidin-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132529028 |
| Molecular Formula | C32H28N2O2 |
| Molecular Weight | 472.59 g/mol |
| Exact Mass | 472.22 |
| IUPAC Name | 2-[(2S,3S)-1-benzhydryl-2-phenylpiperidin-3-yl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1[C@H]1CCCN(C(c2ccccc2)c2ccccc2)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C32H28N2O2/c35-31-26-19-10-11-20-27(26)32(36)34(31)28-21-12-22-33(30(28)25-17-8-3-9-18-25)29(23-13-4-1-5-14-23)24-15-6-2-7-16-24/h1-11,13-20,28-30H,12,21-22H2/t28-,30-/m0/s1 |
| InChIKey | RAPVCXPZXLMKGV-JDXGNMNLSA-N |
| XLogP | 6.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.59 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|