C27H27N3O2 — CID 14295610
2-[2-(4-benzhydrylpiperazin-1-yl)ethyl]isoindole-1,3-dione (PubChem CID 14295610) has the molecular formula C27H27N3O2 and a molecular weight of 425.53 g/mol. Its IUPAC name is 2-[2-(4-benzhydrylpiperazin-1-yl)ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-(4-benzhydrylpiperazin-1-yl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 14295610 |
| Molecular Formula | C27H27N3O2 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.21 |
| IUPAC Name | 2-[2-(4-benzhydrylpiperazin-1-yl)ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H27N3O2/c31-26-23-13-7-8-14-24(23)27(32)30(26)20-17-28-15-18-29(19-16-28)25(21-9-3-1-4-10-21)22-11-5-2-6-12-22/h1-14,25H,15-20H2 |
| InChIKey | HCKXQDKUSXMTRX-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|