C30H33N3O2 — CID 15181797
4-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 15181797) has the molecular formula C30H33N3O2 and a molecular weight of 467.61 g/mol. Its IUPAC name is 4-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | 4-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 15181797 |
| Molecular Formula | C30H33N3O2 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.26 |
| IUPAC Name | 4-[2-(4-benzhydrylpiperazin-1-yl)ethyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C1C2C3C=CC(C4CC34)C2C(=O)N1CCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C30H33N3O2/c34-29-26-22-11-12-23(25-19-24(22)25)27(26)30(35)33(29)18-15-31-13-16-32(17-14-31)28(20-7-3-1-4-8-20)21-9-5-2-6-10-21/h1-12,22-28H,13-19H2 |
| InChIKey | ZEABYCXQNJNAHU-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|