C19H14N2O4 — CID 10640444
2-(2,6-dioxo-5-phenylpiperidin-3-yl)isoindole-1,3-dione (PubChem CID 10640444) has the molecular formula C19H14N2O4 and a molecular weight of 334.33 g/mol. Its IUPAC name is 2-(2,6-dioxo-5-phenylpiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 2-(2,6-dioxo-5-phenylpiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 10640444 |
| Molecular Formula | C19H14N2O4 |
| Molecular Weight | 334.33 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-(2,6-dioxo-5-phenylpiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1NC(=O)C(N2C(=O)c3ccccc3C2=O)CC1c1ccccc1 |
| InChI | InChI=1S/C19H14N2O4/c22-16-14(11-6-2-1-3-7-11)10-15(17(23)20-16)21-18(24)12-8-4-5-9-13(12)19(21)25/h1-9,14-15H,10H2,(H,20,22,23) |
| InChIKey | CNLJMMLBJYVTPG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|