C13H11N3O4 — CID 135273269
2-(1-methyl-2,4-dioxo-1,3-diazinan-5-yl)isoindole-1,3-dione (PubChem CID 135273269) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-(1-methyl-2,4-dioxo-1,3-diazinan-5-yl)isoindole-1,3-dione.
| Compound Name | 2-(1-methyl-2,4-dioxo-1,3-diazinan-5-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 135273269 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-(1-methyl-2,4-dioxo-1,3-diazinan-5-yl)isoindole-1,3-dione |
| SMILES | CN1CC(N2C(=O)c3ccccc3C2=O)C(=O)NC1=O |
| InChI | InChI=1S/C13H11N3O4/c1-15-6-9(10(17)14-13(15)20)16-11(18)7-4-2-3-5-8(7)12(16)19/h2-5,9H,6H2,1H3,(H,14,17,20) |
| InChIKey | LZNLOWXWWYOBQI-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|