C15H12N2O6 — CID 10805336
[5-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl] acetate (PubChem CID 10805336) has the molecular formula C15H12N2O6 and a molecular weight of 316.27 g/mol. Its IUPAC name is [5-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl] acetate.
| Compound Name | [5-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl] acetate |
|---|---|
| PubChem CID | 10805336 |
| Molecular Formula | C15H12N2O6 |
| Molecular Weight | 316.27 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | [5-(1,3-dioxoisoindol-2-yl)-2,6-dioxopiperidin-3-yl] acetate |
| SMILES | CC(=O)OC1CC(N2C(=O)c3ccccc3C2=O)C(=O)NC1=O |
| InChI | InChI=1S/C15H12N2O6/c1-7(18)23-11-6-10(12(19)16-13(11)20)17-14(21)8-4-2-3-5-9(8)15(17)22/h2-5,10-11H,6H2,1H3,(H,16,19,20) |
| InChIKey | GLPALMXLLOSTFC-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|