C17H12N2O4 — CID 13375158
2-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl)isoindole-1,3-dione (PubChem CID 13375158) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl)isoindole-1,3-dione.
| Compound Name | 2-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 13375158 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-(4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1Nc2ccccc2OCC1N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H12N2O4/c20-15-13(9-23-14-8-4-3-7-12(14)18-15)19-16(21)10-5-1-2-6-11(10)17(19)22/h1-8,13H,9H2,(H,18,20) |
| InChIKey | XFLQRAPTPYTJMM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|