C20H19N3OS — CID 58956734
[4-(2-oxopyrrolidin-1-yl)-2-phenyl-1,2,3,4-tetrahydroquinolin-6-yl] thiocyanate (PubChem CID 58956734) has the molecular formula C20H19N3OS and a molecular weight of 349.46 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)-2-phenyl-1,2,3,4-tetrahydroquinolin-6-yl] thiocyanate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)-2-phenyl-1,2,3,4-tetrahydroquinolin-6-yl] thiocyanate |
|---|---|
| PubChem CID | 58956734 |
| Molecular Formula | C20H19N3OS |
| Molecular Weight | 349.46 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)-2-phenyl-1,2,3,4-tetrahydroquinolin-6-yl] thiocyanate |
| SMILES | N#CSc1ccc2c(c1)C(N1CCCC1=O)CC(c1ccccc1)N2 |
| InChI | InChI=1S/C20H19N3OS/c21-13-25-15-8-9-17-16(11-15)19(23-10-4-7-20(23)24)12-18(22-17)14-5-2-1-3-6-14/h1-3,5-6,8-9,11,18-19,22H,4,7,10,12H2 |
| InChIKey | ZJYHTIJTBNCCND-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.46 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|