C17H18N2O2 — CID 102178991
1-[2-(furan-2-yl)-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one (PubChem CID 102178991) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one.
| Compound Name | 1-[2-(furan-2-yl)-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 102178991 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 1-[2-(furan-2-yl)-1,2,3,4-tetrahydroquinolin-4-yl]pyrrolidin-2-one |
| SMILES | O=C1CCCN1C1CC(c2ccco2)Nc2ccccc21 |
| InChI | InChI=1S/C17H18N2O2/c20-17-8-3-9-19(17)15-11-14(16-7-4-10-21-16)18-13-6-2-1-5-12(13)15/h1-2,4-7,10,14-15,18H,3,8-9,11H2 |
| InChIKey | MHOCCKGJJHPMSM-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |