C20H24N2Si — CID 73407805
4-[4-(trimethylsilylmethyl)-1,2,3,4-tetrahydroquinolin-2-yl]benzonitrile (PubChem CID 73407805) has the molecular formula C20H24N2Si and a molecular weight of 320.51 g/mol. Its IUPAC name is 4-[4-(trimethylsilylmethyl)-1,2,3,4-tetrahydroquinolin-2-yl]benzonitrile.
| Compound Name | 4-[4-(trimethylsilylmethyl)-1,2,3,4-tetrahydroquinolin-2-yl]benzonitrile |
|---|---|
| PubChem CID | 73407805 |
| Molecular Formula | C20H24N2Si |
| Molecular Weight | 320.51 g/mol |
| Exact Mass | 320.17 |
| IUPAC Name | 4-[4-(trimethylsilylmethyl)-1,2,3,4-tetrahydroquinolin-2-yl]benzonitrile |
| SMILES | C[Si](C)(C)CC1CC(c2ccc(C#N)cc2)Nc2ccccc21 |
| InChI | InChI=1S/C20H24N2Si/c1-23(2,3)14-17-12-20(16-10-8-15(13-21)9-11-16)22-19-7-5-4-6-18(17)19/h4-11,17,20,22H,12,14H2,1-3H3 |
| InChIKey | NHYPKSVRPPGHGS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.51 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|