C18H19NO — CID 102052144
(2S,4R)-4-ethenyl-6-methoxy-2-phenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 102052144) has the molecular formula C18H19NO and a molecular weight of 265.36 g/mol. Its IUPAC name is (2S,4R)-4-ethenyl-6-methoxy-2-phenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S,4R)-4-ethenyl-6-methoxy-2-phenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 102052144 |
| Molecular Formula | C18H19NO |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (2S,4R)-4-ethenyl-6-methoxy-2-phenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | C=C[C@H]1C[C@@H](c2ccccc2)Nc2ccc(OC)cc21 |
| InChI | InChI=1S/C18H19NO/c1-3-13-11-18(14-7-5-4-6-8-14)19-17-10-9-15(20-2)12-16(13)17/h3-10,12-13,18-19H,1,11H2,2H3/t13-,18-/m0/s1 |
| InChIKey | CUZYFFBJRWEYGQ-UGSOOPFHSA-N |
| XLogP | 4.52 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|