C17H16F3NO — CID 23237017
(2S,4R)-6-methoxy-4-phenyl-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 23237017) has the molecular formula C17H16F3NO and a molecular weight of 307.31 g/mol. Its IUPAC name is (2S,4R)-6-methoxy-4-phenyl-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | (2S,4R)-6-methoxy-4-phenyl-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 23237017 |
| Molecular Formula | C17H16F3NO |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | (2S,4R)-6-methoxy-4-phenyl-2-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc2c(c1)[C@@H](c1ccccc1)C[C@@H](C(F)(F)F)N2 |
| InChI | InChI=1S/C17H16F3NO/c1-22-12-7-8-15-14(9-12)13(11-5-3-2-4-6-11)10-16(21-15)17(18,19)20/h2-9,13,16,21H,10H2,1H3/t13-,16+/m1/s1 |
| InChIKey | CITUTIYQAMKDFM-CJNGLKHVSA-N |
| XLogP | 4.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|