C21H27NO — CID 11809044
(2R,4R)-1-butyl-6-methoxy-2-methyl-4-phenyl-3,4-dihydro-2H-quinoline (PubChem CID 11809044) has the molecular formula C21H27NO and a molecular weight of 309.45 g/mol. Its IUPAC name is (2R,4R)-1-butyl-6-methoxy-2-methyl-4-phenyl-3,4-dihydro-2H-quinoline.
| Compound Name | (2R,4R)-1-butyl-6-methoxy-2-methyl-4-phenyl-3,4-dihydro-2H-quinoline |
|---|---|
| PubChem CID | 11809044 |
| Molecular Formula | C21H27NO |
| Molecular Weight | 309.45 g/mol |
| Exact Mass | 309.21 |
| IUPAC Name | (2R,4R)-1-butyl-6-methoxy-2-methyl-4-phenyl-3,4-dihydro-2H-quinoline |
| SMILES | CCCCN1c2ccc(OC)cc2[C@@H](c2ccccc2)C[C@H]1C |
| InChI | InChI=1S/C21H27NO/c1-4-5-13-22-16(2)14-19(17-9-7-6-8-10-17)20-15-18(23-3)11-12-21(20)22/h6-12,15-16,19H,4-5,13-14H2,1-3H3/t16-,19-/m1/s1 |
| InChIKey | BEHSJDKCJQHJBL-VQIMIIECSA-N |
| XLogP | 5.23 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.45 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|