C15H23NO — CID 83960216
5-methoxy-1,3-dipropyl-2,3-dihydroindole (PubChem CID 83960216) has the molecular formula C15H23NO and a molecular weight of 233.35 g/mol. Its IUPAC name is 5-methoxy-1,3-dipropyl-2,3-dihydroindole.
| Compound Name | 5-methoxy-1,3-dipropyl-2,3-dihydroindole |
|---|---|
| PubChem CID | 83960216 |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 g/mol |
| Exact Mass | 233.18 |
| IUPAC Name | 5-methoxy-1,3-dipropyl-2,3-dihydroindole |
| SMILES | CCCC1CN(CCC)c2ccc(OC)cc21 |
| InChI | InChI=1S/C15H23NO/c1-4-6-12-11-16(9-5-2)15-8-7-13(17-3)10-14(12)15/h7-8,10,12H,4-6,9,11H2,1-3H3 |
| InChIKey | ZFSXZPYKMMTAOV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|