C18H26N2O2 — CID 11044863
1-(1-butyl-6-methoxy-3,4-dihydro-2H-quinolin-4-yl)pyrrolidin-2-one (PubChem CID 11044863) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 1-(1-butyl-6-methoxy-3,4-dihydro-2H-quinolin-4-yl)pyrrolidin-2-one.
| Compound Name | 1-(1-butyl-6-methoxy-3,4-dihydro-2H-quinolin-4-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 11044863 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | 1-(1-butyl-6-methoxy-3,4-dihydro-2H-quinolin-4-yl)pyrrolidin-2-one |
| SMILES | CCCCN1CCC(N2CCCC2=O)c2cc(OC)ccc21 |
| InChI | InChI=1S/C18H26N2O2/c1-3-4-10-19-12-9-17(20-11-5-6-18(20)21)15-13-14(22-2)7-8-16(15)19/h7-8,13,17H,3-6,9-12H2,1-2H3 |
| InChIKey | IJGQOZCCKXXAAY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|