C18H20O2 — CID 132967211
5-methoxy-2-phenyl-3-propyl-2,3-dihydro-1-benzofuran (PubChem CID 132967211) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 5-methoxy-2-phenyl-3-propyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-methoxy-2-phenyl-3-propyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 132967211 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 5-methoxy-2-phenyl-3-propyl-2,3-dihydro-1-benzofuran |
| SMILES | CCCC1c2cc(OC)ccc2OC1c1ccccc1 |
| InChI | InChI=1S/C18H20O2/c1-3-7-15-16-12-14(19-2)10-11-17(16)20-18(15)13-8-5-4-6-9-13/h4-6,8-12,15,18H,3,7H2,1-2H3 |
| InChIKey | XVPJJFLGTNSHAI-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |