C17H17NO — CID 167260146
2-methoxy-5-methyl-6,10b-dihydro-5aH-indeno[2,1-b]indole (PubChem CID 167260146) has the molecular formula C17H17NO and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-methoxy-5-methyl-6,10b-dihydro-5aH-indeno[2,1-b]indole.
| Compound Name | 2-methoxy-5-methyl-6,10b-dihydro-5aH-indeno[2,1-b]indole |
|---|---|
| PubChem CID | 167260146 |
| Molecular Formula | C17H17NO |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.13 |
| IUPAC Name | 2-methoxy-5-methyl-6,10b-dihydro-5aH-indeno[2,1-b]indole |
| SMILES | COc1ccc2c(c1)C1c3ccccc3CC1N2C |
| InChI | InChI=1S/C17H17NO/c1-18-15-8-7-12(19-2)10-14(15)17-13-6-4-3-5-11(13)9-16(17)18/h3-8,10,16-17H,9H2,1-2H3 |
| InChIKey | AUXIVMHJHQKRRT-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|