C26H22N2O3 — CID 139148235
(1R,2S,6R)-9-methoxy-4-phenyl-4,13-diazapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-7(12),8,10,16,18,20-hexaene-3,5-dione (PubChem CID 139148235) has the molecular formula C26H22N2O3 and a molecular weight of 410.47 g/mol. Its IUPAC name is (1R,2S,6R)-9-methoxy-4-phenyl-4,13-diazapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-7(12),8,10,16,18,20-hexaene-3,5-dione.
| Compound Name | (1R,2S,6R)-9-methoxy-4-phenyl-4,13-diazapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-7(12),8,10,16,18,20-hexaene-3,5-dione |
|---|---|
| PubChem CID | 139148235 |
| Molecular Formula | C26H22N2O3 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | (1R,2S,6R)-9-methoxy-4-phenyl-4,13-diazapentacyclo[11.8.0.02,6.07,12.016,21]henicosa-7(12),8,10,16,18,20-hexaene-3,5-dione |
| SMILES | COc1ccc2c(c1)[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]1[C@@H]1c3ccccc3CCN21 |
| InChI | InChI=1S/C26H22N2O3/c1-31-18-11-12-21-20(15-18)22-23(24-19-10-6-5-7-16(19)13-14-27(21)24)26(30)28(25(22)29)17-8-3-2-4-9-17/h2-12,15,22-24H,13-14H2,1H3/t22-,23-,24-/m0/s1 |
| InChIKey | LQCWXHUXISMOJG-HJOGWXRNSA-N |
| XLogP | 4.09 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|