C21H19NO4 — CID 70045768
3-(10-methoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-13-yl)prop-2-enoic acid (PubChem CID 70045768) has the molecular formula C21H19NO4 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-(10-methoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-13-yl)prop-2-enoic acid.
| Compound Name | 3-(10-methoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-13-yl)prop-2-enoic acid |
|---|---|
| PubChem CID | 70045768 |
| Molecular Formula | C21H19NO4 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | 3-(10-methoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-13-yl)prop-2-enoic acid |
| SMILES | COc1ccc2c(c1)C(=O)N1CCc3ccccc3C1C2C=CC(=O)O |
| InChI | InChI=1S/C21H19NO4/c1-26-14-6-7-16-17(8-9-19(23)24)20-15-5-3-2-4-13(15)10-11-22(20)21(25)18(16)12-14/h2-9,12,17,20H,10-11H2,1H3,(H,23,24) |
| InChIKey | GDMASBNOWLYVNK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|