C32H35N3O4 — CID 98462633
(13S,13aS)-10,11-dimethoxy-13-[(3R)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 98462633) has the molecular formula C32H35N3O4 and a molecular weight of 525.65 g/mol. Its IUPAC name is (13S,13aS)-10,11-dimethoxy-13-[(3R)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | (13S,13aS)-10,11-dimethoxy-13-[(3R)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 98462633 |
| Molecular Formula | C32H35N3O4 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.26 |
| IUPAC Name | (13S,13aS)-10,11-dimethoxy-13-[(3R)-3-methyl-4-(3-methylphenyl)piperazine-1-carbonyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | COc1cc2c(cc1OC)[C@H](C(=O)N1CCN(c3cccc(C)c3)[C@H](C)C1)[C@H]1c3ccccc3CCN1C2=O |
| InChI | InChI=1S/C32H35N3O4/c1-20-8-7-10-23(16-20)34-15-14-33(19-21(34)2)32(37)29-25-17-27(38-3)28(39-4)18-26(25)31(36)35-13-12-22-9-5-6-11-24(22)30(29)35/h5-11,16-18,21,29-30H,12-15,19H2,1-4H3/t21-,29+,30-/m1/s1 |
| InChIKey | KVZIIHZSDPWGNK-HAQLSYKPSA-N |
| XLogP | 4.59 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |