C31H33N3O4 — CID 92656116
(13R,13aR)-13-(4-benzylpiperazine-1-carbonyl)-2,3-dimethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 92656116) has the molecular formula C31H33N3O4 and a molecular weight of 511.62 g/mol. Its IUPAC name is (13R,13aR)-13-(4-benzylpiperazine-1-carbonyl)-2,3-dimethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | (13R,13aR)-13-(4-benzylpiperazine-1-carbonyl)-2,3-dimethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 92656116 |
| Molecular Formula | C31H33N3O4 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | (13R,13aR)-13-(4-benzylpiperazine-1-carbonyl)-2,3-dimethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@H](C(=O)N3CCN(Cc4ccccc4)CC3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C31H33N3O4/c1-37-26-18-22-12-13-34-29(25(22)19-27(26)38-2)28(23-10-6-7-11-24(23)30(34)35)31(36)33-16-14-32(15-17-33)20-21-8-4-3-5-9-21/h3-11,18-19,28-29H,12-17,20H2,1-2H3/t28-,29+/m1/s1 |
| InChIKey | UVIFHFKXEINQLW-WDYNHAJCSA-N |
| XLogP | 3.88 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |