C29H35N3O6 — CID 92656371
ethyl 4-[(13R,13aS)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl]piperazine-1-carboxylate (PubChem CID 92656371) has the molecular formula C29H35N3O6 and a molecular weight of 521.61 g/mol. Its IUPAC name is ethyl 4-[(13R,13aS)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl]piperazine-1-carboxylate.
| Compound Name | ethyl 4-[(13R,13aS)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 92656371 |
| Molecular Formula | C29H35N3O6 |
| Molecular Weight | 521.61 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | ethyl 4-[(13R,13aS)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl]piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(C(=O)[C@@H]2c3ccccc3C(=O)N3CCc4cc(OCC)c(OCC)cc4[C@H]23)CC1 |
| InChI | InChI=1S/C29H35N3O6/c1-4-36-23-17-19-11-12-32-26(22(19)18-24(23)37-5-2)25(20-9-7-8-10-21(20)27(32)33)28(34)30-13-15-31(16-14-30)29(35)38-6-3/h7-10,17-18,25-26H,4-6,11-16H2,1-3H3/t25-,26-/m1/s1 |
| InChIKey | RIHVFMVXBHGFPF-CLJLJLNGSA-N |
| XLogP | 3.62 |
| TPSA | 88.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.61 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |