C30H36N2O6 — CID 92656400
ethyl (3R)-1-[(13S,13aS)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl]piperidine-3-carboxylate (PubChem CID 92656400) has the molecular formula C30H36N2O6 and a molecular weight of 520.63 g/mol. Its IUPAC name is ethyl (3R)-1-[(13S,13aS)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl]piperidine-3-carboxylate.
| Compound Name | ethyl (3R)-1-[(13S,13aS)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 92656400 |
| Molecular Formula | C30H36N2O6 |
| Molecular Weight | 520.63 g/mol |
| Exact Mass | 520.26 |
| IUPAC Name | ethyl (3R)-1-[(13S,13aS)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CCCN(C(=O)[C@H]2c3ccccc3C(=O)N3CCc4cc(OCC)c(OCC)cc4[C@H]23)C1 |
| InChI | InChI=1S/C30H36N2O6/c1-4-36-24-16-19-13-15-32-27(23(19)17-25(24)37-5-2)26(21-11-7-8-12-22(21)28(32)33)29(34)31-14-9-10-20(18-31)30(35)38-6-3/h7-8,11-12,16-17,20,26-27H,4-6,9-10,13-15,18H2,1-3H3/t20-,26+,27-/m1/s1 |
| InChIKey | ICSCZERPVGSSTN-JAMKYWPSSA-N |
| XLogP | 4.12 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.63 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |