C19H24N2O4 — CID 108521887
ethyl 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoacetyl]piperidine-3-carboxylate (PubChem CID 108521887) has the molecular formula C19H24N2O4 and a molecular weight of 344.41 g/mol. Its IUPAC name is ethyl 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoacetyl]piperidine-3-carboxylate.
| Compound Name | ethyl 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoacetyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 108521887 |
| Molecular Formula | C19H24N2O4 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | ethyl 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-2-oxoacetyl]piperidine-3-carboxylate |
| SMILES | CCOC(=O)C1CCCN(C(=O)C(=O)N2CCc3ccccc3C2)C1 |
| InChI | InChI=1S/C19H24N2O4/c1-2-25-19(24)16-8-5-10-20(13-16)17(22)18(23)21-11-9-14-6-3-4-7-15(14)12-21/h3-4,6-7,16H,2,5,8-13H2,1H3 |
| InChIKey | SPLIXMBHIZIYIV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|