C28H27ClN2O4 — CID 15999960
N-(3-chlorophenyl)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 15999960) has the molecular formula C28H27ClN2O4 and a molecular weight of 490.99 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 15999960 |
| Molecular Formula | C28H27ClN2O4 |
| Molecular Weight | 490.99 g/mol |
| Exact Mass | 490.17 |
| IUPAC Name | N-(3-chlorophenyl)-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | CCOc1cc2c(cc1OCC)C1C(C(=O)Nc3cccc(Cl)c3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C28H27ClN2O4/c1-3-34-23-14-17-12-13-31-26(22(17)16-24(23)35-4-2)25(20-10-5-6-11-21(20)28(31)33)27(32)30-19-9-7-8-18(29)15-19/h5-11,14-16,25-26H,3-4,12-13H2,1-2H3,(H,30,32) |
| InChIKey | JWFZFYWCGIJJIZ-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.99 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |