C29H29N3O6 — CID 92656486
(13S,13aS)-2,3-diethoxy-N-(2-methyl-3-nitrophenyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 92656486) has the molecular formula C29H29N3O6 and a molecular weight of 515.57 g/mol. Its IUPAC name is (13S,13aS)-2,3-diethoxy-N-(2-methyl-3-nitrophenyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | (13S,13aS)-2,3-diethoxy-N-(2-methyl-3-nitrophenyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 92656486 |
| Molecular Formula | C29H29N3O6 |
| Molecular Weight | 515.57 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | (13S,13aS)-2,3-diethoxy-N-(2-methyl-3-nitrophenyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | CCOc1cc2c(cc1OCC)[C@@H]1[C@@H](C(=O)Nc3cccc([N+](=O)[O-])c3C)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C29H29N3O6/c1-4-37-24-15-18-13-14-31-27(21(18)16-25(24)38-5-2)26(19-9-6-7-10-20(19)29(31)34)28(33)30-22-11-8-12-23(17(22)3)32(35)36/h6-12,15-16,26-27H,4-5,13-14H2,1-3H3,(H,30,33)/t26-,27+/m0/s1 |
| InChIKey | YNCBMUPEVCQXKI-RRPNLBNLSA-N |
| XLogP | 5.18 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.57 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|