C32H34N4O6 — CID 92853930
(13S,13aS)-2,3-diethoxy-13-[4-(4-nitrophenyl)piperazine-1-carbonyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 92853930) has the molecular formula C32H34N4O6 and a molecular weight of 570.65 g/mol. Its IUPAC name is (13S,13aS)-2,3-diethoxy-13-[4-(4-nitrophenyl)piperazine-1-carbonyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | (13S,13aS)-2,3-diethoxy-13-[4-(4-nitrophenyl)piperazine-1-carbonyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 92853930 |
| Molecular Formula | C32H34N4O6 |
| Molecular Weight | 570.65 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | (13S,13aS)-2,3-diethoxy-13-[4-(4-nitrophenyl)piperazine-1-carbonyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | CCOc1cc2c(cc1OCC)[C@@H]1[C@@H](C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C32H34N4O6/c1-3-41-27-19-21-13-14-35-30(26(21)20-28(27)42-4-2)29(24-7-5-6-8-25(24)31(35)37)32(38)34-17-15-33(16-18-34)22-9-11-23(12-10-22)36(39)40/h5-12,19-20,29-30H,3-4,13-18H2,1-2H3/t29-,30+/m0/s1 |
| InChIKey | NLFXDEWIBIYGOP-XZWHSSHBSA-N |
| XLogP | 4.58 |
| TPSA | 105.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.65 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|