C35H41FN4O4 — CID 92853937
(13R,13aR)-2,3-diethoxy-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 92853937) has the molecular formula C35H41FN4O4 and a molecular weight of 600.74 g/mol. Its IUPAC name is (13R,13aR)-2,3-diethoxy-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | (13R,13aR)-2,3-diethoxy-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 92853937 |
| Molecular Formula | C35H41FN4O4 |
| Molecular Weight | 600.74 g/mol |
| Exact Mass | 600.31 |
| IUPAC Name | (13R,13aR)-2,3-diethoxy-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | CCOc1cc2c(cc1OCC)[C@H]1[C@H](C(=O)NCCCN3CCN(c4ccc(F)cc4)CC3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C35H41FN4O4/c1-3-43-30-22-24-14-17-40-33(29(24)23-31(30)44-4-2)32(27-8-5-6-9-28(27)35(40)42)34(41)37-15-7-16-38-18-20-39(21-19-38)26-12-10-25(36)11-13-26/h5-6,8-13,22-23,32-33H,3-4,7,14-21H2,1-2H3,(H,37,41)/t32-,33+/m1/s1 |
| InChIKey | HZCSRCVVKNMIKL-SAIUNTKASA-N |
| XLogP | 4.79 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.74 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|