C27H33N3O5 — CID 122174788
2,3-dimethoxy-N-(3-morpholin-4-ylpropyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 122174788) has the molecular formula C27H33N3O5 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2,3-dimethoxy-N-(3-morpholin-4-ylpropyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | 2,3-dimethoxy-N-(3-morpholin-4-ylpropyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 122174788 |
| Molecular Formula | C27H33N3O5 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2,3-dimethoxy-N-(3-morpholin-4-ylpropyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | COc1cc2c(cc1OC)C1C(C(=O)NCCCN3CCOCC3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C27H33N3O5/c1-33-22-16-18-8-11-30-25(21(18)17-23(22)34-2)24(19-6-3-4-7-20(19)27(30)32)26(31)28-9-5-10-29-12-14-35-15-13-29/h3-4,6-7,16-17,24-25H,5,8-15H2,1-2H3,(H,28,31) |
| InChIKey | UEWSVBMQNPRLEV-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 80.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|