C28H32N2O4 — CID 5322890
N-[2-(cyclohexen-1-yl)ethyl]-2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 5322890) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[2-(cyclohexen-1-yl)ethyl]-2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | N-[2-(cyclohexen-1-yl)ethyl]-2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 5322890 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[2-(cyclohexen-1-yl)ethyl]-2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | COc1cc2c(cc1OC)C1C(C(=O)NCCC3=CCCCC3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C28H32N2O4/c1-33-23-16-19-13-15-30-26(22(19)17-24(23)34-2)25(20-10-6-7-11-21(20)28(30)32)27(31)29-14-12-18-8-4-3-5-9-18/h6-8,10-11,16-17,25-26H,3-5,9,12-15H2,1-2H3,(H,29,31) |
| InChIKey | PVOASHAWLBQUEW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|