C28H33N3O6 — CID 46247910
ethyl 4-[(2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl)amino]piperidine-1-carboxylate (PubChem CID 46247910) has the molecular formula C28H33N3O6 and a molecular weight of 507.59 g/mol. Its IUPAC name is ethyl 4-[(2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl)amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[(2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl)amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 46247910 |
| Molecular Formula | C28H33N3O6 |
| Molecular Weight | 507.59 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | ethyl 4-[(2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carbonyl)amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(NC(=O)C2c3ccccc3C(=O)N3CCc4cc(OC)c(OC)cc4C23)CC1 |
| InChI | InChI=1S/C28H33N3O6/c1-4-37-28(34)30-12-10-18(11-13-30)29-26(32)24-19-7-5-6-8-20(19)27(33)31-14-9-17-15-22(35-2)23(36-3)16-21(17)25(24)31/h5-8,15-16,18,24-25H,4,9-14H2,1-3H3,(H,29,32) |
| InChIKey | UXHOAFPXLAXDSB-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.59 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |