C30H31BrN2O5 — CID 92853989
(13R,13aR)-N-[(5-bromo-2-methoxyphenyl)methyl]-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 92853989) has the molecular formula C30H31BrN2O5 and a molecular weight of 579.49 g/mol. Its IUPAC name is (13R,13aR)-N-[(5-bromo-2-methoxyphenyl)methyl]-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | (13R,13aR)-N-[(5-bromo-2-methoxyphenyl)methyl]-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 92853989 |
| Molecular Formula | C30H31BrN2O5 |
| Molecular Weight | 579.49 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (13R,13aR)-N-[(5-bromo-2-methoxyphenyl)methyl]-2,3-diethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | CCOc1cc2c(cc1OCC)[C@H]1[C@H](C(=O)NCc3cc(Br)ccc3OC)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C30H31BrN2O5/c1-4-37-25-15-18-12-13-33-28(23(18)16-26(25)38-5-2)27(21-8-6-7-9-22(21)30(33)35)29(34)32-17-19-14-20(31)10-11-24(19)36-3/h6-11,14-16,27-28H,4-5,12-13,17H2,1-3H3,(H,32,34)/t27-,28+/m1/s1 |
| InChIKey | GKEWPZOEESTZGG-IZLXSDGUSA-N |
| XLogP | 5.41 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.49 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |