C28H27BrN2O5 — CID 92853964
(13S,13aR)-N-[(5-bromo-2-methoxyphenyl)methyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 92853964) has the molecular formula C28H27BrN2O5 and a molecular weight of 551.44 g/mol. Its IUPAC name is (13S,13aR)-N-[(5-bromo-2-methoxyphenyl)methyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | (13S,13aR)-N-[(5-bromo-2-methoxyphenyl)methyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 92853964 |
| Molecular Formula | C28H27BrN2O5 |
| Molecular Weight | 551.44 g/mol |
| Exact Mass | 550.11 |
| IUPAC Name | (13S,13aR)-N-[(5-bromo-2-methoxyphenyl)methyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | COc1ccc(Br)cc1CNC(=O)[C@H]1c2cc(OC)c(OC)cc2C(=O)N2CCc3ccccc3[C@@H]12 |
| InChI | InChI=1S/C28H27BrN2O5/c1-34-22-9-8-18(29)12-17(22)15-30-27(32)25-20-13-23(35-2)24(36-3)14-21(20)28(33)31-11-10-16-6-4-5-7-19(16)26(25)31/h4-9,12-14,25-26H,10-11,15H2,1-3H3,(H,30,32)/t25-,26-/m0/s1 |
| InChIKey | ROTPGNPWNMKDTK-UIOOFZCWSA-N |
| XLogP | 4.63 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |