C27H35N3O4 — CID 22334484
N-[2-[butyl(methyl)amino]ethyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 22334484) has the molecular formula C27H35N3O4 and a molecular weight of 465.59 g/mol. Its IUPAC name is N-[2-[butyl(methyl)amino]ethyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | N-[2-[butyl(methyl)amino]ethyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 22334484 |
| Molecular Formula | C27H35N3O4 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.26 |
| IUPAC Name | N-[2-[butyl(methyl)amino]ethyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | CCCCN(C)CCNC(=O)C1c2cc(OC)c(OC)cc2C(=O)N2CCc3ccccc3C12 |
| InChI | InChI=1S/C27H35N3O4/c1-5-6-13-29(2)15-12-28-26(31)24-20-16-22(33-3)23(34-4)17-21(20)27(32)30-14-11-18-9-7-8-10-19(18)25(24)30/h7-10,16-17,24-25H,5-6,11-15H2,1-4H3,(H,28,31) |
| InChIKey | FNFZTPMXWUYCTA-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |