C27H25N3O7 — CID 92660683
(13R,13aR)-10,11-dimethoxy-N-(2-methoxy-5-nitrophenyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 92660683) has the molecular formula C27H25N3O7 and a molecular weight of 503.51 g/mol. Its IUPAC name is (13R,13aR)-10,11-dimethoxy-N-(2-methoxy-5-nitrophenyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | (13R,13aR)-10,11-dimethoxy-N-(2-methoxy-5-nitrophenyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 92660683 |
| Molecular Formula | C27H25N3O7 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.17 |
| IUPAC Name | (13R,13aR)-10,11-dimethoxy-N-(2-methoxy-5-nitrophenyl)-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@@H]1c2cc(OC)c(OC)cc2C(=O)N2CCc3ccccc3[C@@H]12 |
| InChI | InChI=1S/C27H25N3O7/c1-35-21-9-8-16(30(33)34)12-20(21)28-26(31)24-18-13-22(36-2)23(37-3)14-19(18)27(32)29-11-10-15-6-4-5-7-17(15)25(24)29/h4-9,12-14,24-25H,10-11H2,1-3H3,(H,28,31)/t24-,25+/m1/s1 |
| InChIKey | XRKMXOLPCYFBDE-RPBOFIJWSA-N |
| XLogP | 4.10 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|