C33H37FN4O4 — CID 92906635
(13R,13aS)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 92906635) has the molecular formula C33H37FN4O4 and a molecular weight of 572.68 g/mol. Its IUPAC name is (13R,13aS)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | (13R,13aS)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 92906635 |
| Molecular Formula | C33H37FN4O4 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | (13R,13aS)-N-[3-[4-(4-fluorophenyl)piperazin-1-yl]propyl]-10,11-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | COc1cc2c(cc1OC)[C@@H](C(=O)NCCCN1CCN(c3ccc(F)cc3)CC1)[C@H]1c3ccccc3CCN1C2=O |
| InChI | InChI=1S/C33H37FN4O4/c1-41-28-20-26-27(21-29(28)42-2)33(40)38-15-12-22-6-3-4-7-25(22)31(38)30(26)32(39)35-13-5-14-36-16-18-37(19-17-36)24-10-8-23(34)9-11-24/h3-4,6-11,20-21,30-31H,5,12-19H2,1-2H3,(H,35,39)/t30-,31-/m1/s1 |
| InChIKey | IOYRLJFIRXMMLC-FIRIVFDPSA-N |
| XLogP | 4.01 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|