C27H23F3N2O4 — CID 92660653
(13R,13aS)-10,11-dimethoxy-8-oxo-N-[3-(trifluoromethyl)phenyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 92660653) has the molecular formula C27H23F3N2O4 and a molecular weight of 496.49 g/mol. Its IUPAC name is (13R,13aS)-10,11-dimethoxy-8-oxo-N-[3-(trifluoromethyl)phenyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | (13R,13aS)-10,11-dimethoxy-8-oxo-N-[3-(trifluoromethyl)phenyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 92660653 |
| Molecular Formula | C27H23F3N2O4 |
| Molecular Weight | 496.49 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | (13R,13aS)-10,11-dimethoxy-8-oxo-N-[3-(trifluoromethyl)phenyl]-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | COc1cc2c(cc1OC)[C@@H](C(=O)Nc1cccc(C(F)(F)F)c1)[C@H]1c3ccccc3CCN1C2=O |
| InChI | InChI=1S/C27H23F3N2O4/c1-35-21-13-19-20(14-22(21)36-2)26(34)32-11-10-15-6-3-4-9-18(15)24(32)23(19)25(33)31-17-8-5-7-16(12-17)27(28,29)30/h3-9,12-14,23-24H,10-11H2,1-2H3,(H,31,33)/t23-,24-/m1/s1 |
| InChIKey | ASWAEARKCDZDFK-DNQXCXABSA-N |
| XLogP | 5.20 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.49 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |