C28H34N2O4 — CID 6621553
N-(2,3-dimethylcyclohexyl)-2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide (PubChem CID 6621553) has the molecular formula C28H34N2O4 and a molecular weight of 462.59 g/mol. Its IUPAC name is N-(2,3-dimethylcyclohexyl)-2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide.
| Compound Name | N-(2,3-dimethylcyclohexyl)-2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
|---|---|
| PubChem CID | 6621553 |
| Molecular Formula | C28H34N2O4 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-(2,3-dimethylcyclohexyl)-2,3-dimethoxy-8-oxo-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinoline-13-carboxamide |
| SMILES | COc1cc2c(cc1OC)C1C(C(=O)NC3CCCC(C)C3C)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C28H34N2O4/c1-16-8-7-11-22(17(16)2)29-27(31)25-19-9-5-6-10-20(19)28(32)30-13-12-18-14-23(33-3)24(34-4)15-21(18)26(25)30/h5-6,9-10,14-17,22,25-26H,7-8,11-13H2,1-4H3,(H,29,31) |
| InChIKey | FADNMTXDBGVASU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |