C32H34ClN3O4 — CID 94850439
(13R,13aR)-13-[4-(3-chlorophenyl)piperazine-1-carbonyl]-2,3-diethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one (PubChem CID 94850439) has the molecular formula C32H34ClN3O4 and a molecular weight of 560.09 g/mol. Its IUPAC name is (13R,13aR)-13-[4-(3-chlorophenyl)piperazine-1-carbonyl]-2,3-diethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one.
| Compound Name | (13R,13aR)-13-[4-(3-chlorophenyl)piperazine-1-carbonyl]-2,3-diethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
|---|---|
| PubChem CID | 94850439 |
| Molecular Formula | C32H34ClN3O4 |
| Molecular Weight | 560.09 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | (13R,13aR)-13-[4-(3-chlorophenyl)piperazine-1-carbonyl]-2,3-diethoxy-5,6,13,13a-tetrahydroisoquinolino[2,1-b]isoquinolin-8-one |
| SMILES | CCOc1cc2c(cc1OCC)[C@H]1[C@H](C(=O)N3CCN(c4cccc(Cl)c4)CC3)c3ccccc3C(=O)N1CC2 |
| InChI | InChI=1S/C32H34ClN3O4/c1-3-39-27-18-21-12-13-36-30(26(21)20-28(27)40-4-2)29(24-10-5-6-11-25(24)31(36)37)32(38)35-16-14-34(15-17-35)23-9-7-8-22(33)19-23/h5-11,18-20,29-30H,3-4,12-17H2,1-2H3/t29-,30+/m1/s1 |
| InChIKey | FTDSOBBFSYXXDR-IHLOFXLRSA-N |
| XLogP | 5.32 |
| TPSA | 62.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.09 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |