C16H21NO3 — CID 115008178
7-methoxy-10-methyl-2,3,4,4a,9,9a-hexahydro-1H-acridine-9-carboxylic acid (PubChem CID 115008178) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is 7-methoxy-10-methyl-2,3,4,4a,9,9a-hexahydro-1H-acridine-9-carboxylic acid.
| Compound Name | 7-methoxy-10-methyl-2,3,4,4a,9,9a-hexahydro-1H-acridine-9-carboxylic acid |
|---|---|
| PubChem CID | 115008178 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | 7-methoxy-10-methyl-2,3,4,4a,9,9a-hexahydro-1H-acridine-9-carboxylic acid |
| SMILES | COc1ccc2c(c1)C(C(=O)O)C1CCCCC1N2C |
| InChI | InChI=1S/C16H21NO3/c1-17-13-6-4-3-5-11(13)15(16(18)19)12-9-10(20-2)7-8-14(12)17/h7-9,11,13,15H,3-6H2,1-2H3,(H,18,19) |
| InChIKey | XHFCYZQZEWRUAN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|