C15H19NO3 — CID 115008152
6-methoxy-1,2,3,4,4a,9,9a,10-octahydroacridine-9-carboxylic acid (PubChem CID 115008152) has the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. Its IUPAC name is 6-methoxy-1,2,3,4,4a,9,9a,10-octahydroacridine-9-carboxylic acid.
| Compound Name | 6-methoxy-1,2,3,4,4a,9,9a,10-octahydroacridine-9-carboxylic acid |
|---|---|
| PubChem CID | 115008152 |
| Molecular Formula | C15H19NO3 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.14 |
| IUPAC Name | 6-methoxy-1,2,3,4,4a,9,9a,10-octahydroacridine-9-carboxylic acid |
| SMILES | COc1ccc2c(c1)NC1CCCCC1C2C(=O)O |
| InChI | InChI=1S/C15H19NO3/c1-19-9-6-7-11-13(8-9)16-12-5-3-2-4-10(12)14(11)15(17)18/h6-8,10,12,14,16H,2-5H2,1H3,(H,17,18) |
| InChIKey | VFMYAJJONWVSDW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |