C13H18N2OS — CID 115008376
7-methoxy-3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinolin-10-amine (PubChem CID 115008376) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 7-methoxy-3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinolin-10-amine.
| Compound Name | 7-methoxy-3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinolin-10-amine |
|---|---|
| PubChem CID | 115008376 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 7-methoxy-3,4,4a,5,10,10a-hexahydro-1H-thiopyrano[4,3-b]quinolin-10-amine |
| SMILES | COc1ccc2c(c1)NC1CCSCC1C2N |
| InChI | InChI=1S/C13H18N2OS/c1-16-8-2-3-9-12(6-8)15-11-4-5-17-7-10(11)13(9)14/h2-3,6,10-11,13,15H,4-5,7,14H2,1H3 |
| InChIKey | FVVMEKGWLZXRPC-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |